C14H19FN2S — CID 103495730
4-(6-fluoro-2,3-dihydroindol-1-yl)-2,2-dimethylbutanethioamide (PubChem CID 103495730) has the molecular formula C14H19FN2S and a molecular weight of 266.38 g/mol. Its IUPAC name is 4-(6-fluoro-2,3-dihydroindol-1-yl)-2,2-dimethylbutanethioamide.
| Compound Name | 4-(6-fluoro-2,3-dihydroindol-1-yl)-2,2-dimethylbutanethioamide |
|---|---|
| PubChem CID | 103495730 |
| Molecular Formula | C14H19FN2S |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 4-(6-fluoro-2,3-dihydroindol-1-yl)-2,2-dimethylbutanethioamide |
| SMILES | CC(C)(CCN1CCc2ccc(F)cc21)C(N)=S |
| InChI | InChI=1S/C14H19FN2S/c1-14(2,13(16)18)6-8-17-7-5-10-3-4-11(15)9-12(10)17/h3-4,9H,5-8H2,1-2H3,(H2,16,18) |
| InChIKey | CLSDWYOFDFDHMY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|