C13H16FN3O2 — CID 103501035
2-(6-fluoro-2,3-dihydroindole-1-carbonyl)-N'-hydroxybutanimidamide (PubChem CID 103501035) has the molecular formula C13H16FN3O2 and a molecular weight of 265.29 g/mol. Its IUPAC name is 2-(6-fluoro-2,3-dihydroindole-1-carbonyl)-N'-hydroxybutanimidamide.
| Compound Name | 2-(6-fluoro-2,3-dihydroindole-1-carbonyl)-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 103501035 |
| Molecular Formula | C13H16FN3O2 |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-(6-fluoro-2,3-dihydroindole-1-carbonyl)-N'-hydroxybutanimidamide |
| SMILES | CCC(C(=O)N1CCc2ccc(F)cc21)/C(N)=N/O |
| InChI | InChI=1S/C13H16FN3O2/c1-2-10(12(15)16-19)13(18)17-6-5-8-3-4-9(14)7-11(8)17/h3-4,7,10,19H,2,5-6H2,1H3,(H2,15,16) |
| InChIKey | ZBOOKYSMRBJGCD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|