C17H16FNOS — CID 107037118
1-(6-fluoro-2,3-dihydroindol-1-yl)-3-phenyl-2-sulfanylpropan-1-one (PubChem CID 107037118) has the molecular formula C17H16FNOS and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-(6-fluoro-2,3-dihydroindol-1-yl)-3-phenyl-2-sulfanylpropan-1-one.
| Compound Name | 1-(6-fluoro-2,3-dihydroindol-1-yl)-3-phenyl-2-sulfanylpropan-1-one |
|---|---|
| PubChem CID | 107037118 |
| Molecular Formula | C17H16FNOS |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 1-(6-fluoro-2,3-dihydroindol-1-yl)-3-phenyl-2-sulfanylpropan-1-one |
| SMILES | O=C(C(S)Cc1ccccc1)N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C17H16FNOS/c18-14-7-6-13-8-9-19(15(13)11-14)17(20)16(21)10-12-4-2-1-3-5-12/h1-7,11,16,21H,8-10H2 |
| InChIKey | XWZHCQVEUPPZAD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|