C13H15BrFNO — CID 103494351
2-bromo-1-(6-fluoro-2,3-dihydroindol-1-yl)-3-methylbutan-1-one (PubChem CID 103494351) has the molecular formula C13H15BrFNO and a molecular weight of 300.17 g/mol. Its IUPAC name is 2-bromo-1-(6-fluoro-2,3-dihydroindol-1-yl)-3-methylbutan-1-one.
| Compound Name | 2-bromo-1-(6-fluoro-2,3-dihydroindol-1-yl)-3-methylbutan-1-one |
|---|---|
| PubChem CID | 103494351 |
| Molecular Formula | C13H15BrFNO |
| Molecular Weight | 300.17 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 2-bromo-1-(6-fluoro-2,3-dihydroindol-1-yl)-3-methylbutan-1-one |
| SMILES | CC(C)C(Br)C(=O)N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C13H15BrFNO/c1-8(2)12(14)13(17)16-6-5-9-3-4-10(15)7-11(9)16/h3-4,7-8,12H,5-6H2,1-2H3 |
| InChIKey | CJUSNOUOQLAFKE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.17 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|