C12H13FN2O3 — CID 103499852
2-[(6-fluoro-2,3-dihydroindole-1-carbonyl)amino]propanoic acid (PubChem CID 103499852) has the molecular formula C12H13FN2O3 and a molecular weight of 252.25 g/mol. Its IUPAC name is 2-[(6-fluoro-2,3-dihydroindole-1-carbonyl)amino]propanoic acid.
| Compound Name | 2-[(6-fluoro-2,3-dihydroindole-1-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 103499852 |
| Molecular Formula | C12H13FN2O3 |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 2-[(6-fluoro-2,3-dihydroindole-1-carbonyl)amino]propanoic acid |
| SMILES | CC(NC(=O)N1CCc2ccc(F)cc21)C(=O)O |
| InChI | InChI=1S/C12H13FN2O3/c1-7(11(16)17)14-12(18)15-5-4-8-2-3-9(13)6-10(8)15/h2-3,6-7H,4-5H2,1H3,(H,14,18)(H,16,17) |
| InChIKey | KXCHJFIIWBAUKO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |