C13H13FN2O5 — CID 103499983
(2R)-2-[(6-fluoro-2,3-dihydroindole-1-carbonyl)amino]butanedioic acid (PubChem CID 103499983) has the molecular formula C13H13FN2O5 and a molecular weight of 296.25 g/mol. Its IUPAC name is (2R)-2-[(6-fluoro-2,3-dihydroindole-1-carbonyl)amino]butanedioic acid.
| Compound Name | (2R)-2-[(6-fluoro-2,3-dihydroindole-1-carbonyl)amino]butanedioic acid |
|---|---|
| PubChem CID | 103499983 |
| Molecular Formula | C13H13FN2O5 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | (2R)-2-[(6-fluoro-2,3-dihydroindole-1-carbonyl)amino]butanedioic acid |
| SMILES | O=C(O)C[C@@H](NC(=O)N1CCc2ccc(F)cc21)C(=O)O |
| InChI | InChI=1S/C13H13FN2O5/c14-8-2-1-7-3-4-16(10(7)5-8)13(21)15-9(12(19)20)6-11(17)18/h1-2,5,9H,3-4,6H2,(H,15,21)(H,17,18)(H,19,20)/t9-/m1/s1 |
| InChIKey | QDOXLXKQBZLGFP-SECBINFHSA-N |
| XLogP | 0.83 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |