2-(2,3-dihydroindole-1-carbonylamino)-4-hydroxybutanoic acid

C13H16N2O4 — CID 61230248

IUPAC2-(2,3-dihydroindole-1-carbonylamino)-4-hydroxybutanoic acid
SMILESO=C(O)C(CCO)NC(=O)N1CCc2ccccc21
InChIInChI=1S/C13H16N2O4/c16-8-6-10(12(17)18)14-13(19)15-7-5-9-3-1-2-4-11(9)15/h1-4,10,16H,5-8H2,(H,14,19)(H,17,18)
InChIKeyDNKABZRJYRKFBT-UHFFFAOYSA-N
MW264.28 g/mol
LogP0.59
Rot. Bonds4

About 2-(2,3-dihydroindole-1-carbonylamino)-4-hydroxybutanoic acid

2-(2,3-dihydroindole-1-carbonylamino)-4-hydroxybutanoic acid (PubChem CID 61230248) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-(2,3-dihydroindole-1-carbonylamino)-4-hydroxybutanoic acid.

Molecular Properties

Compound Name2-(2,3-dihydroindole-1-carbonylamino)-4-hydroxybutanoic acid
PubChem CID61230248
Molecular FormulaC13H16N2O4
Molecular Weight264.28 g/mol
Exact Mass264.11
IUPAC Name2-(2,3-dihydroindole-1-carbonylamino)-4-hydroxybutanoic acid
SMILESO=C(O)C(CCO)NC(=O)N1CCc2ccccc21
InChIInChI=1S/C13H16N2O4/c16-8-6-10(12(17)18)14-13(19)15-7-5-9-3-1-2-4-11(9)15/h1-4,10,16H,5-8H2,(H,14,19)(H,17,18)
InChIKeyDNKABZRJYRKFBT-UHFFFAOYSA-N
XLogP0.59
TPSA89.87 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.28
LogP ≤ 50.59
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-(2,3-dihydroindole-1-carbonylamino)-4-hydroxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3-dihydroindole-1-carbonylamino)-4-hydroxybutanoic acid?
The IUPAC name of 2-(2,3-dihydroindole-1-carbonylamino)-4-hydroxybutanoic acid (CID 61230248) is 2-(2,3-dihydroindole-1-carbonylamino)-4-hydroxybutanoic acid.
What is the SMILES notation for 2-(2,3-dihydroindole-1-carbonylamino)-4-hydroxybutanoic acid?
The canonical SMILES for 2-(2,3-dihydroindole-1-carbonylamino)-4-hydroxybutanoic acid is O=C(O)C(CCO)NC(=O)N1CCc2ccccc21.
What is the InChIKey of 2-(2,3-dihydroindole-1-carbonylamino)-4-hydroxybutanoic acid?
The InChIKey is DNKABZRJYRKFBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O4/c16-8-6-10(12(17)18)14-13(19)15-7-5-9-3-1-2-4-11(9)15/h1-4,10,16H,5-8H2,(H,14,19)(H,17,18).
What are the key properties of 2-(2,3-dihydroindole-1-carbonylamino)-4-hydroxybutanoic acid?
2-(2,3-dihydroindole-1-carbonylamino)-4-hydroxybutanoic acid has a molecular weight of 264.28 g/mol, XLogP of 0.59, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydroindole-1-carbonylamino)-4-hydroxybutanoic acid is sourced from PubChem (CID 61230248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).