C18H24N2O3 — CID 166748735
3-cyclohexyl-2-(2,3-dihydroindole-1-carbonylamino)propanoic acid (PubChem CID 166748735) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 3-cyclohexyl-2-(2,3-dihydroindole-1-carbonylamino)propanoic acid.
| Compound Name | 3-cyclohexyl-2-(2,3-dihydroindole-1-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 166748735 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 3-cyclohexyl-2-(2,3-dihydroindole-1-carbonylamino)propanoic acid |
| SMILES | O=C(O)C(CC1CCCCC1)NC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C18H24N2O3/c21-17(22)15(12-13-6-2-1-3-7-13)19-18(23)20-11-10-14-8-4-5-9-16(14)20/h4-5,8-9,13,15H,1-3,6-7,10-12H2,(H,19,23)(H,21,22) |
| InChIKey | SDAVKCMXLPGCSD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |