C16H16N4O3 — CID 166257935
2-(2,3-dihydroindole-1-carbonylamino)-3-pyrimidin-2-ylpropanoic acid (PubChem CID 166257935) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is 2-(2,3-dihydroindole-1-carbonylamino)-3-pyrimidin-2-ylpropanoic acid.
| Compound Name | 2-(2,3-dihydroindole-1-carbonylamino)-3-pyrimidin-2-ylpropanoic acid |
|---|---|
| PubChem CID | 166257935 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 2-(2,3-dihydroindole-1-carbonylamino)-3-pyrimidin-2-ylpropanoic acid |
| SMILES | O=C(O)C(Cc1ncccn1)NC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C16H16N4O3/c21-15(22)12(10-14-17-7-3-8-18-14)19-16(23)20-9-6-11-4-1-2-5-13(11)20/h1-5,7-8,12H,6,9-10H2,(H,19,23)(H,21,22) |
| InChIKey | TZSBLEXABSRIQQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |