C18H18N6O — CID 99210544
N-[(1R)-1-(1-phenyltetrazol-5-yl)ethyl]-2,3-dihydroindole-1-carboxamide (PubChem CID 99210544) has the molecular formula C18H18N6O and a molecular weight of 334.38 g/mol. Its IUPAC name is N-[(1R)-1-(1-phenyltetrazol-5-yl)ethyl]-2,3-dihydroindole-1-carboxamide.
| Compound Name | N-[(1R)-1-(1-phenyltetrazol-5-yl)ethyl]-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 99210544 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | N-[(1R)-1-(1-phenyltetrazol-5-yl)ethyl]-2,3-dihydroindole-1-carboxamide |
| SMILES | C[C@@H](NC(=O)N1CCc2ccccc21)c1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C18H18N6O/c1-13(17-20-21-22-24(17)15-8-3-2-4-9-15)19-18(25)23-12-11-14-7-5-6-10-16(14)23/h2-10,13H,11-12H2,1H3,(H,19,25)/t13-/m1/s1 |
| InChIKey | KPSZHLINRRSXDT-CYBMUJFWSA-N |
| XLogP | 2.50 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |