C18H22N6O — CID 96518819
(3aS,7aS)-N-[(1S)-1-(1-phenyltetrazol-5-yl)ethyl]-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide (PubChem CID 96518819) has the molecular formula C18H22N6O and a molecular weight of 338.42 g/mol. Its IUPAC name is (3aS,7aS)-N-[(1S)-1-(1-phenyltetrazol-5-yl)ethyl]-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide.
| Compound Name | (3aS,7aS)-N-[(1S)-1-(1-phenyltetrazol-5-yl)ethyl]-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 96518819 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (3aS,7aS)-N-[(1S)-1-(1-phenyltetrazol-5-yl)ethyl]-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide |
| SMILES | C[C@H](NC(=O)N1C[C@H]2CC=CC[C@@H]2C1)c1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C18H22N6O/c1-13(17-20-21-22-24(17)16-9-3-2-4-10-16)19-18(25)23-11-14-7-5-6-8-15(14)12-23/h2-6,9-10,13-15H,7-8,11-12H2,1H3,(H,19,25)/t13-,14+,15+/m0/s1 |
| InChIKey | QVCIDEDLDFZGAS-RRFJBIMHSA-N |
| XLogP | 2.33 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|