C23H31N3O2 — CID 67772918
(2S)-N-[(2S)-1-cyclobutyl-5-(2,3-dihydroindol-1-yl)-5-oxopent-3-en-2-yl]piperidine-2-carboxamide (PubChem CID 67772918) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-cyclobutyl-5-(2,3-dihydroindol-1-yl)-5-oxopent-3-en-2-yl]piperidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S)-1-cyclobutyl-5-(2,3-dihydroindol-1-yl)-5-oxopent-3-en-2-yl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 67772918 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | (2S)-N-[(2S)-1-cyclobutyl-5-(2,3-dihydroindol-1-yl)-5-oxopent-3-en-2-yl]piperidine-2-carboxamide |
| SMILES | O=C(N[C@H](C=CC(=O)N1CCc2ccccc21)CC1CCC1)[C@@H]1CCCCN1 |
| InChI | InChI=1S/C23H31N3O2/c27-22(26-15-13-18-8-1-2-10-21(18)26)12-11-19(16-17-6-5-7-17)25-23(28)20-9-3-4-14-24-20/h1-2,8,10-12,17,19-20,24H,3-7,9,13-16H2,(H,25,28)/t19-,20+/m1/s1 |
| InChIKey | GGXMWDPTSQFTDH-UXHICEINSA-N |
| XLogP | 2.95 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|