C26H31N3O2 — CID 140583705
N-[(E,3S)-6-(2,3-dihydroindol-1-yl)-6-oxo-1-phenylhex-4-en-3-yl]piperidine-2-carboxamide (PubChem CID 140583705) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is N-[(E,3S)-6-(2,3-dihydroindol-1-yl)-6-oxo-1-phenylhex-4-en-3-yl]piperidine-2-carboxamide.
| Compound Name | N-[(E,3S)-6-(2,3-dihydroindol-1-yl)-6-oxo-1-phenylhex-4-en-3-yl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 140583705 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | N-[(E,3S)-6-(2,3-dihydroindol-1-yl)-6-oxo-1-phenylhex-4-en-3-yl]piperidine-2-carboxamide |
| SMILES | O=C(N[C@H](/C=C/C(=O)N1CCc2ccccc21)CCc1ccccc1)C1CCCCN1 |
| InChI | InChI=1S/C26H31N3O2/c30-25(29-19-17-21-10-4-5-12-24(21)29)16-15-22(14-13-20-8-2-1-3-9-20)28-26(31)23-11-6-7-18-27-23/h1-5,8-10,12,15-16,22-23,27H,6-7,11,13-14,17-19H2,(H,28,31)/b16-15+/t22-,23?/m0/s1 |
| InChIKey | DWUSLROWEIFKSD-JDBHEERASA-N |
| XLogP | 3.39 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|