C24H29N3O2 — CID 67772432
(2S)-2-amino-N-[(3S)-6-(2,3-dihydroindol-1-yl)-6-oxo-1-phenylhex-4-en-3-yl]butanamide (PubChem CID 67772432) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is (2S)-2-amino-N-[(3S)-6-(2,3-dihydroindol-1-yl)-6-oxo-1-phenylhex-4-en-3-yl]butanamide.
| Compound Name | (2S)-2-amino-N-[(3S)-6-(2,3-dihydroindol-1-yl)-6-oxo-1-phenylhex-4-en-3-yl]butanamide |
|---|---|
| PubChem CID | 67772432 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | (2S)-2-amino-N-[(3S)-6-(2,3-dihydroindol-1-yl)-6-oxo-1-phenylhex-4-en-3-yl]butanamide |
| SMILES | CC[C@H](N)C(=O)N[C@H](C=CC(=O)N1CCc2ccccc21)CCc1ccccc1 |
| InChI | InChI=1S/C24H29N3O2/c1-2-21(25)24(29)26-20(13-12-18-8-4-3-5-9-18)14-15-23(28)27-17-16-19-10-6-7-11-22(19)27/h3-11,14-15,20-21H,2,12-13,16-17,25H2,1H3,(H,26,29)/t20-,21-/m0/s1 |
| InChIKey | LWVLTPOWFCWXGE-SFTDATJTSA-N |
| XLogP | 2.99 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|