C26H26F3N3O4 — CID 67773060
[(2S)-2-[[(E,3S)-6-(2,3-dihydroindol-1-yl)-6-oxo-1-phenylhex-4-en-3-yl]carbamoyl]azetidin-1-yl] 2,2,2-trifluoroacetate (PubChem CID 67773060) has the molecular formula C26H26F3N3O4 and a molecular weight of 501.51 g/mol. Its IUPAC name is [(2S)-2-[[(E,3S)-6-(2,3-dihydroindol-1-yl)-6-oxo-1-phenylhex-4-en-3-yl]carbamoyl]azetidin-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(2S)-2-[[(E,3S)-6-(2,3-dihydroindol-1-yl)-6-oxo-1-phenylhex-4-en-3-yl]carbamoyl]azetidin-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67773060 |
| Molecular Formula | C26H26F3N3O4 |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | [(2S)-2-[[(E,3S)-6-(2,3-dihydroindol-1-yl)-6-oxo-1-phenylhex-4-en-3-yl]carbamoyl]azetidin-1-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C(N[C@H](/C=C/C(=O)N1CCc2ccccc21)CCc1ccccc1)[C@@H]1CCN1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C26H26F3N3O4/c27-26(28,29)25(35)36-32-17-15-22(32)24(34)30-20(11-10-18-6-2-1-3-7-18)12-13-23(33)31-16-14-19-8-4-5-9-21(19)31/h1-9,12-13,20,22H,10-11,14-17H2,(H,30,34)/b13-12+/t20-,22-/m0/s1 |
| InChIKey | OQEPQGSKEKUYTC-ISRFRVOZSA-N |
| XLogP | 3.34 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|