C19H24FN3O2 — CID 140583622
(2S)-N-[(E,3S)-6-(2,3-dihydroindol-1-yl)-6-oxohex-4-en-3-yl]-4-fluoropyrrolidine-2-carboxamide (PubChem CID 140583622) has the molecular formula C19H24FN3O2 and a molecular weight of 345.42 g/mol. Its IUPAC name is (2S)-N-[(E,3S)-6-(2,3-dihydroindol-1-yl)-6-oxohex-4-en-3-yl]-4-fluoropyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(E,3S)-6-(2,3-dihydroindol-1-yl)-6-oxohex-4-en-3-yl]-4-fluoropyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 140583622 |
| Molecular Formula | C19H24FN3O2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | (2S)-N-[(E,3S)-6-(2,3-dihydroindol-1-yl)-6-oxohex-4-en-3-yl]-4-fluoropyrrolidine-2-carboxamide |
| SMILES | CC[C@@H](/C=C/C(=O)N1CCc2ccccc21)NC(=O)[C@@H]1CC(F)CN1 |
| InChI | InChI=1S/C19H24FN3O2/c1-2-15(22-19(25)16-11-14(20)12-21-16)7-8-18(24)23-10-9-13-5-3-4-6-17(13)23/h3-8,14-16,21H,2,9-12H2,1H3,(H,22,25)/b8-7+/t14?,15-,16-/m0/s1 |
| InChIKey | OHJONXYDUFMZGG-JFECKLEMSA-N |
| XLogP | 1.73 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|