C22H29FN2O2 — CID 159516230
(E,4R)-1-(2,3-dihydroindol-1-yl)-6-[(2S,4S)-4-fluoropyrrolidin-2-yl]-4-(2-methylpropyl)hex-2-ene-1,6-dione (PubChem CID 159516230) has the molecular formula C22H29FN2O2 and a molecular weight of 372.48 g/mol. Its IUPAC name is (E,4R)-1-(2,3-dihydroindol-1-yl)-6-[(2S,4S)-4-fluoropyrrolidin-2-yl]-4-(2-methylpropyl)hex-2-ene-1,6-dione.
| Compound Name | (E,4R)-1-(2,3-dihydroindol-1-yl)-6-[(2S,4S)-4-fluoropyrrolidin-2-yl]-4-(2-methylpropyl)hex-2-ene-1,6-dione |
|---|---|
| PubChem CID | 159516230 |
| Molecular Formula | C22H29FN2O2 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | (E,4R)-1-(2,3-dihydroindol-1-yl)-6-[(2S,4S)-4-fluoropyrrolidin-2-yl]-4-(2-methylpropyl)hex-2-ene-1,6-dione |
| SMILES | CC(C)C[C@@H](/C=C/C(=O)N1CCc2ccccc21)CC(=O)[C@@H]1C[C@H](F)CN1 |
| InChI | InChI=1S/C22H29FN2O2/c1-15(2)11-16(12-21(26)19-13-18(23)14-24-19)7-8-22(27)25-10-9-17-5-3-4-6-20(17)25/h3-8,15-16,18-19,24H,9-14H2,1-2H3/b8-7+/t16-,18+,19+/m1/s1 |
| InChIKey | FBANZWXJCZKFCJ-COZULRHNSA-N |
| XLogP | 3.45 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|