C27H30N2O2 — CID 159423878
(E,4R)-6-[(1S,2S,5R)-3-azabicyclo[3.1.0]hexan-2-yl]-1-(2,3-dihydroindol-1-yl)-4-(2-phenylethyl)hex-2-ene-1,6-dione (PubChem CID 159423878) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is (E,4R)-6-[(1S,2S,5R)-3-azabicyclo[3.1.0]hexan-2-yl]-1-(2,3-dihydroindol-1-yl)-4-(2-phenylethyl)hex-2-ene-1,6-dione.
| Compound Name | (E,4R)-6-[(1S,2S,5R)-3-azabicyclo[3.1.0]hexan-2-yl]-1-(2,3-dihydroindol-1-yl)-4-(2-phenylethyl)hex-2-ene-1,6-dione |
|---|---|
| PubChem CID | 159423878 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | (E,4R)-6-[(1S,2S,5R)-3-azabicyclo[3.1.0]hexan-2-yl]-1-(2,3-dihydroindol-1-yl)-4-(2-phenylethyl)hex-2-ene-1,6-dione |
| SMILES | O=C(C[C@H](/C=C/C(=O)N1CCc2ccccc21)CCc1ccccc1)[C@H]1NC[C@@H]2C[C@@H]21 |
| InChI | InChI=1S/C27H30N2O2/c30-25(27-23-17-22(23)18-28-27)16-20(11-10-19-6-2-1-3-7-19)12-13-26(31)29-15-14-21-8-4-5-9-24(21)29/h1-9,12-13,20,22-23,27-28H,10-11,14-18H2/b13-12+/t20-,22-,23-,27-/m0/s1 |
| InChIKey | LQCFPYCUXCWTJZ-PHCGCGMASA-N |
| XLogP | 3.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|