C21H26N2O2 — CID 123837849
5-amino-1-(2,3-dihydroindol-1-yl)-4-hydroxy-7-phenylheptan-1-one (PubChem CID 123837849) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 5-amino-1-(2,3-dihydroindol-1-yl)-4-hydroxy-7-phenylheptan-1-one.
| Compound Name | 5-amino-1-(2,3-dihydroindol-1-yl)-4-hydroxy-7-phenylheptan-1-one |
|---|---|
| PubChem CID | 123837849 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 5-amino-1-(2,3-dihydroindol-1-yl)-4-hydroxy-7-phenylheptan-1-one |
| SMILES | NC(CCc1ccccc1)C(O)CCC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C21H26N2O2/c22-18(11-10-16-6-2-1-3-7-16)20(24)12-13-21(25)23-15-14-17-8-4-5-9-19(17)23/h1-9,18,20,24H,10-15,22H2 |
| InChIKey | IEKCUVSKAKOAGM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |