C22H27N3O2 — CID 119784082
3-amino-N-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]-2-methyl-3-phenylpropanamide (PubChem CID 119784082) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 3-amino-N-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]-2-methyl-3-phenylpropanamide.
| Compound Name | 3-amino-N-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]-2-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 119784082 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 3-amino-N-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]-2-methyl-3-phenylpropanamide |
| SMILES | CC(C(=O)NCCCC(=O)N1CCc2ccccc21)C(N)c1ccccc1 |
| InChI | InChI=1S/C22H27N3O2/c1-16(21(23)18-9-3-2-4-10-18)22(27)24-14-7-12-20(26)25-15-13-17-8-5-6-11-19(17)25/h2-6,8-11,16,21H,7,12-15,23H2,1H3,(H,24,27) |
| InChIKey | XBZOMVISPNQEFU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|