C28H30N2O3S — CID 55535580
2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-N-[3-(1-phenylethoxy)propyl]benzamide (PubChem CID 55535580) has the molecular formula C28H30N2O3S and a molecular weight of 474.63 g/mol. Its IUPAC name is 2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-N-[3-(1-phenylethoxy)propyl]benzamide.
| Compound Name | 2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-N-[3-(1-phenylethoxy)propyl]benzamide |
|---|---|
| PubChem CID | 55535580 |
| Molecular Formula | C28H30N2O3S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-N-[3-(1-phenylethoxy)propyl]benzamide |
| SMILES | CC(OCCCNC(=O)c1ccccc1SCC(=O)N1CCc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C28H30N2O3S/c1-21(22-10-3-2-4-11-22)33-19-9-17-29-28(32)24-13-6-8-15-26(24)34-20-27(31)30-18-16-23-12-5-7-14-25(23)30/h2-8,10-15,21H,9,16-20H2,1H3,(H,29,32) |
| InChIKey | ZJENJFCXAKDEEL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|