C21H26ClN3O2S — CID 119506702
2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-N-[2-(ethylamino)ethyl]benzamide;hydrochloride (PubChem CID 119506702) has the molecular formula C21H26ClN3O2S and a molecular weight of 419.98 g/mol. Its IUPAC name is 2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-N-[2-(ethylamino)ethyl]benzamide;hydrochloride.
| Compound Name | 2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-N-[2-(ethylamino)ethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119506702 |
| Molecular Formula | C21H26ClN3O2S |
| Molecular Weight | 419.98 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-N-[2-(ethylamino)ethyl]benzamide;hydrochloride |
| SMILES | CCNCCNC(=O)c1ccccc1SCC(=O)N1CCc2ccccc21.Cl |
| InChI | InChI=1S/C21H25N3O2S.ClH/c1-2-22-12-13-23-21(26)17-8-4-6-10-19(17)27-15-20(25)24-14-11-16-7-3-5-9-18(16)24;/h3-10,22H,2,11-15H2,1H3,(H,23,26);1H |
| InChIKey | WBDHFDSTFIJFPS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.98 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|