C20H24ClN3O2S — CID 119406624
N-(3-aminopropyl)-2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylbenzamide;hydrochloride (PubChem CID 119406624) has the molecular formula C20H24ClN3O2S and a molecular weight of 405.95 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylbenzamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119406624 |
| Molecular Formula | C20H24ClN3O2S |
| Molecular Weight | 405.95 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-(3-aminopropyl)-2-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylbenzamide;hydrochloride |
| SMILES | Cl.NCCCNC(=O)c1ccccc1SCC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C20H23N3O2S.ClH/c21-11-5-12-22-20(25)16-7-2-4-9-18(16)26-14-19(24)23-13-10-15-6-1-3-8-17(15)23;/h1-4,6-9H,5,10-14,21H2,(H,22,25);1H |
| InChIKey | YXCCNDHRFZSDBF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.95 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|