C16H24ClN3O2S — CID 119407692
N-(3-aminopropyl)-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzamide;hydrochloride (PubChem CID 119407692) has the molecular formula C16H24ClN3O2S and a molecular weight of 357.91 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119407692 |
| Molecular Formula | C16H24ClN3O2S |
| Molecular Weight | 357.91 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N-(3-aminopropyl)-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzamide;hydrochloride |
| SMILES | Cl.NCCCNC(=O)c1ccccc1SCC(=O)N1CCCC1 |
| InChI | InChI=1S/C16H23N3O2S.ClH/c17-8-5-9-18-16(21)13-6-1-2-7-14(13)22-12-15(20)19-10-3-4-11-19;/h1-2,6-7H,3-5,8-12,17H2,(H,18,21);1H |
| InChIKey | MARVLNNNCTWIAQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.91 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|