C27H36N4O3S — CID 39990130
N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzamide (PubChem CID 39990130) has the molecular formula C27H36N4O3S and a molecular weight of 496.68 g/mol. Its IUPAC name is N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzamide.
| Compound Name | N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzamide |
|---|---|
| PubChem CID | 39990130 |
| Molecular Formula | C27H36N4O3S |
| Molecular Weight | 496.68 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzamide |
| SMILES | COc1ccc(N2CCN(CCCNC(=O)c3ccccc3SCC(=O)N3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C27H36N4O3S/c1-34-23-11-9-22(10-12-23)30-19-17-29(18-20-30)14-6-13-28-27(33)24-7-2-3-8-25(24)35-21-26(32)31-15-4-5-16-31/h2-3,7-12H,4-6,13-21H2,1H3,(H,28,33) |
| InChIKey | YGQGLUDKTPKTCI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.68 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|