C31H39N5O4 — CID 43957356
N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-oxo-2-[1-(2-oxo-2-piperidin-1-ylethyl)indol-3-yl]acetamide (PubChem CID 43957356) has the molecular formula C31H39N5O4 and a molecular weight of 545.68 g/mol. Its IUPAC name is N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-oxo-2-[1-(2-oxo-2-piperidin-1-ylethyl)indol-3-yl]acetamide.
| Compound Name | N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-oxo-2-[1-(2-oxo-2-piperidin-1-ylethyl)indol-3-yl]acetamide |
|---|---|
| PubChem CID | 43957356 |
| Molecular Formula | C31H39N5O4 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.30 |
| IUPAC Name | N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-oxo-2-[1-(2-oxo-2-piperidin-1-ylethyl)indol-3-yl]acetamide |
| SMILES | COc1ccc(N2CCN(CCCNC(=O)C(=O)c3cn(CC(=O)N4CCCCC4)c4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C31H39N5O4/c1-40-25-12-10-24(11-13-25)34-20-18-33(19-21-34)15-7-14-32-31(39)30(38)27-22-36(28-9-4-3-8-26(27)28)23-29(37)35-16-5-2-6-17-35/h3-4,8-13,22H,2,5-7,14-21,23H2,1H3,(H,32,39) |
| InChIKey | LCVVDSIEXXNUAX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|