C30H39N5O4 — CID 41429515
2-[1-[2-(diethylamino)-2-oxoethyl]indol-3-yl]-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-oxoacetamide (PubChem CID 41429515) has the molecular formula C30H39N5O4 and a molecular weight of 533.67 g/mol. Its IUPAC name is 2-[1-[2-(diethylamino)-2-oxoethyl]indol-3-yl]-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-oxoacetamide.
| Compound Name | 2-[1-[2-(diethylamino)-2-oxoethyl]indol-3-yl]-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 41429515 |
| Molecular Formula | C30H39N5O4 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.30 |
| IUPAC Name | 2-[1-[2-(diethylamino)-2-oxoethyl]indol-3-yl]-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2-oxoacetamide |
| SMILES | CCN(CC)C(=O)Cn1cc(C(=O)C(=O)NCCCN2CCN(c3ccc(OC)cc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C30H39N5O4/c1-4-33(5-2)28(36)22-35-21-26(25-9-6-7-10-27(25)35)29(37)30(38)31-15-8-16-32-17-19-34(20-18-32)23-11-13-24(39-3)14-12-23/h6-7,9-14,21H,4-5,8,15-20,22H2,1-3H3,(H,31,38) |
| InChIKey | ZPLJEEKOFLOTRA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|