C24H31N5O2 — CID 122175814
2-indazol-1-yl-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]propanamide (PubChem CID 122175814) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is 2-indazol-1-yl-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]propanamide.
| Compound Name | 2-indazol-1-yl-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]propanamide |
|---|---|
| PubChem CID | 122175814 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 2-indazol-1-yl-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]propanamide |
| SMILES | COc1ccc(N2CCN(CCCNC(=O)C(C)n3ncc4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C24H31N5O2/c1-19(29-23-7-4-3-6-20(23)18-26-29)24(30)25-12-5-13-27-14-16-28(17-15-27)21-8-10-22(31-2)11-9-21/h3-4,6-11,18-19H,5,12-17H2,1-2H3,(H,25,30) |
| InChIKey | KXCBDKMYPHLWPM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|