C30H34N4O4 — CID 24891905
1-[4-(4-acetylphenyl)piperazin-1-yl]-2-[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]ethane-1,2-dione (PubChem CID 24891905) has the molecular formula C30H34N4O4 and a molecular weight of 514.63 g/mol. Its IUPAC name is 1-[4-(4-acetylphenyl)piperazin-1-yl]-2-[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]ethane-1,2-dione.
| Compound Name | 1-[4-(4-acetylphenyl)piperazin-1-yl]-2-[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 24891905 |
| Molecular Formula | C30H34N4O4 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | 1-[4-(4-acetylphenyl)piperazin-1-yl]-2-[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]ethane-1,2-dione |
| SMILES | CC(=O)c1ccc(N2CCN(C(=O)C(=O)c3cn(CC(=O)N4CCCCCC4)c4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C30H34N4O4/c1-22(35)23-10-12-24(13-11-23)31-16-18-33(19-17-31)30(38)29(37)26-20-34(27-9-5-4-8-25(26)27)21-28(36)32-14-6-2-3-7-15-32/h4-5,8-13,20H,2-3,6-7,14-19,21H2,1H3 |
| InChIKey | IBWUYWJRVTWOGW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 82.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|