C25H27N3O3 — CID 43957368
2-[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]-N-methyl-2-oxo-N-phenylacetamide (PubChem CID 43957368) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]-N-methyl-2-oxo-N-phenylacetamide.
| Compound Name | 2-[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]-N-methyl-2-oxo-N-phenylacetamide |
|---|---|
| PubChem CID | 43957368 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 2-[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]-N-methyl-2-oxo-N-phenylacetamide |
| SMILES | CN(C(=O)C(=O)c1cn(CC(=O)N2CCCCCC2)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C25H27N3O3/c1-26(19-11-5-4-6-12-19)25(31)24(30)21-17-28(22-14-8-7-13-20(21)22)18-23(29)27-15-9-2-3-10-16-27/h4-8,11-14,17H,2-3,9-10,15-16,18H2,1H3 |
| InChIKey | HKWZPTVQLGPUCN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|