C28H33N3O3 — CID 41429622
N-benzyl-N-butyl-2-oxo-2-[1-(2-oxo-2-piperidin-1-ylethyl)indol-3-yl]acetamide (PubChem CID 41429622) has the molecular formula C28H33N3O3 and a molecular weight of 459.59 g/mol. Its IUPAC name is N-benzyl-N-butyl-2-oxo-2-[1-(2-oxo-2-piperidin-1-ylethyl)indol-3-yl]acetamide.
| Compound Name | N-benzyl-N-butyl-2-oxo-2-[1-(2-oxo-2-piperidin-1-ylethyl)indol-3-yl]acetamide |
|---|---|
| PubChem CID | 41429622 |
| Molecular Formula | C28H33N3O3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | N-benzyl-N-butyl-2-oxo-2-[1-(2-oxo-2-piperidin-1-ylethyl)indol-3-yl]acetamide |
| SMILES | CCCCN(Cc1ccccc1)C(=O)C(=O)c1cn(CC(=O)N2CCCCC2)c2ccccc12 |
| InChI | InChI=1S/C28H33N3O3/c1-2-3-16-30(19-22-12-6-4-7-13-22)28(34)27(33)24-20-31(25-15-9-8-14-23(24)25)21-26(32)29-17-10-5-11-18-29/h4,6-9,12-15,20H,2-3,5,10-11,16-19,21H2,1H3 |
| InChIKey | AIXVDBXXFLKVRT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|