C27H32N4O4 — CID 30288578
N-[3-[benzyl(methyl)amino]propyl]-2-[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]-2-oxoacetamide (PubChem CID 30288578) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)amino]propyl]-2-[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]-2-oxoacetamide.
| Compound Name | N-[3-[benzyl(methyl)amino]propyl]-2-[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 30288578 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | N-[3-[benzyl(methyl)amino]propyl]-2-[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]-2-oxoacetamide |
| SMILES | CN(CCCNC(=O)C(=O)c1cn(CC(=O)N2CCOCC2)c2ccccc12)Cc1ccccc1 |
| InChI | InChI=1S/C27H32N4O4/c1-29(18-21-8-3-2-4-9-21)13-7-12-28-27(34)26(33)23-19-31(24-11-6-5-10-22(23)24)20-25(32)30-14-16-35-17-15-30/h2-6,8-11,19H,7,12-18,20H2,1H3,(H,28,34) |
| InChIKey | QNZUOGRDFFPYJA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|