C22H31N4O4+ — CID 7162351
diethyl-[2-[[2-[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]-2-oxoacetyl]amino]ethyl]azanium (PubChem CID 7162351) has the molecular formula C22H31N4O4+ and a molecular weight of 415.51 g/mol. Its IUPAC name is diethyl-[2-[[2-[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]-2-oxoacetyl]amino]ethyl]azanium.
| Compound Name | diethyl-[2-[[2-[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]-2-oxoacetyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 7162351 |
| Molecular Formula | C22H31N4O4+ |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | diethyl-[2-[[2-[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]-2-oxoacetyl]amino]ethyl]azanium |
| SMILES | CC[NH+](CC)CCNC(=O)C(=O)c1cn(CC(=O)N2CCOCC2)c2ccccc12 |
| InChI | InChI=1S/C22H30N4O4/c1-3-24(4-2)10-9-23-22(29)21(28)18-15-26(19-8-6-5-7-17(18)19)16-20(27)25-11-13-30-14-12-25/h5-8,15H,3-4,9-14,16H2,1-2H3,(H,23,29)/p+1 |
| InChIKey | QKILJVDSZHKYCM-UHFFFAOYSA-O |
| XLogP | -0.28 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|