C22H29N3O5 — CID 40506565
N,N-bis(2-methoxyethyl)-2-oxo-2-[1-(2-oxo-2-pyrrolidin-1-ylethyl)indol-3-yl]acetamide (PubChem CID 40506565) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is N,N-bis(2-methoxyethyl)-2-oxo-2-[1-(2-oxo-2-pyrrolidin-1-ylethyl)indol-3-yl]acetamide.
| Compound Name | N,N-bis(2-methoxyethyl)-2-oxo-2-[1-(2-oxo-2-pyrrolidin-1-ylethyl)indol-3-yl]acetamide |
|---|---|
| PubChem CID | 40506565 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | N,N-bis(2-methoxyethyl)-2-oxo-2-[1-(2-oxo-2-pyrrolidin-1-ylethyl)indol-3-yl]acetamide |
| SMILES | COCCN(CCOC)C(=O)C(=O)c1cn(CC(=O)N2CCCC2)c2ccccc12 |
| InChI | InChI=1S/C22H29N3O5/c1-29-13-11-24(12-14-30-2)22(28)21(27)18-15-25(19-8-4-3-7-17(18)19)16-20(26)23-9-5-6-10-23/h3-4,7-8,15H,5-6,9-14,16H2,1-2H3 |
| InChIKey | NLWBDTMWFRBOAL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|