C24H33N3O3 — CID 40506563
N,N-dibutyl-2-oxo-2-[1-(2-oxo-2-pyrrolidin-1-ylethyl)indol-3-yl]acetamide (PubChem CID 40506563) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is N,N-dibutyl-2-oxo-2-[1-(2-oxo-2-pyrrolidin-1-ylethyl)indol-3-yl]acetamide.
| Compound Name | N,N-dibutyl-2-oxo-2-[1-(2-oxo-2-pyrrolidin-1-ylethyl)indol-3-yl]acetamide |
|---|---|
| PubChem CID | 40506563 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | N,N-dibutyl-2-oxo-2-[1-(2-oxo-2-pyrrolidin-1-ylethyl)indol-3-yl]acetamide |
| SMILES | CCCCN(CCCC)C(=O)C(=O)c1cn(CC(=O)N2CCCC2)c2ccccc12 |
| InChI | InChI=1S/C24H33N3O3/c1-3-5-13-26(14-6-4-2)24(30)23(29)20-17-27(21-12-8-7-11-19(20)21)18-22(28)25-15-9-10-16-25/h7-8,11-12,17H,3-6,9-10,13-16,18H2,1-2H3 |
| InChIKey | SLUKKNKJKSCQKL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|