C27H31N3O3 — CID 41429642
2-[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]-N-benzyl-N-ethyl-2-oxoacetamide (PubChem CID 41429642) has the molecular formula C27H31N3O3 and a molecular weight of 445.56 g/mol. Its IUPAC name is 2-[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]-N-benzyl-N-ethyl-2-oxoacetamide.
| Compound Name | 2-[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]-N-benzyl-N-ethyl-2-oxoacetamide |
|---|---|
| PubChem CID | 41429642 |
| Molecular Formula | C27H31N3O3 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 2-[1-[2-(azepan-1-yl)-2-oxoethyl]indol-3-yl]-N-benzyl-N-ethyl-2-oxoacetamide |
| SMILES | CCN(Cc1ccccc1)C(=O)C(=O)c1cn(CC(=O)N2CCCCCC2)c2ccccc12 |
| InChI | InChI=1S/C27H31N3O3/c1-2-28(18-21-12-6-5-7-13-21)27(33)26(32)23-19-30(24-15-9-8-14-22(23)24)20-25(31)29-16-10-3-4-11-17-29/h5-9,12-15,19H,2-4,10-11,16-18,20H2,1H3 |
| InChIKey | ZEAZETKGFREUEP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|