C23H26N2O3S — CID 20902787
1-(azepan-1-yl)-2-(3-benzylsulfonylindol-1-yl)ethanone (PubChem CID 20902787) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-(3-benzylsulfonylindol-1-yl)ethanone.
| Compound Name | 1-(azepan-1-yl)-2-(3-benzylsulfonylindol-1-yl)ethanone |
|---|---|
| PubChem CID | 20902787 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 1-(azepan-1-yl)-2-(3-benzylsulfonylindol-1-yl)ethanone |
| SMILES | O=C(Cn1cc(S(=O)(=O)Cc2ccccc2)c2ccccc21)N1CCCCCC1 |
| InChI | InChI=1S/C23H26N2O3S/c26-23(24-14-8-1-2-9-15-24)17-25-16-22(20-12-6-7-13-21(20)25)29(27,28)18-19-10-4-3-5-11-19/h3-7,10-13,16H,1-2,8-9,14-15,17-18H2 |
| InChIKey | HNYRYFZXNIMIPO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |