C30H32N2O3S — CID 30559357
1-(4-benzylpiperidin-1-yl)-2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]ethanone (PubChem CID 30559357) has the molecular formula C30H32N2O3S and a molecular weight of 500.66 g/mol. Its IUPAC name is 1-(4-benzylpiperidin-1-yl)-2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]ethanone.
| Compound Name | 1-(4-benzylpiperidin-1-yl)-2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]ethanone |
|---|---|
| PubChem CID | 30559357 |
| Molecular Formula | C30H32N2O3S |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 1-(4-benzylpiperidin-1-yl)-2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]ethanone |
| SMILES | Cc1ccc(CS(=O)(=O)c2cn(CC(=O)N3CCC(Cc4ccccc4)CC3)c3ccccc23)cc1 |
| InChI | InChI=1S/C30H32N2O3S/c1-23-11-13-26(14-12-23)22-36(34,35)29-20-32(28-10-6-5-9-27(28)29)21-30(33)31-17-15-25(16-18-31)19-24-7-3-2-4-8-24/h2-14,20,25H,15-19,21-22H2,1H3 |
| InChIKey | ANRWYPCXWTZWMD-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |