C23H23F3N2O3S — CID 20902781
1-piperidin-1-yl-2-[3-[[4-(trifluoromethyl)phenyl]methylsulfonyl]indol-1-yl]ethanone (PubChem CID 20902781) has the molecular formula C23H23F3N2O3S and a molecular weight of 464.51 g/mol. Its IUPAC name is 1-piperidin-1-yl-2-[3-[[4-(trifluoromethyl)phenyl]methylsulfonyl]indol-1-yl]ethanone.
| Compound Name | 1-piperidin-1-yl-2-[3-[[4-(trifluoromethyl)phenyl]methylsulfonyl]indol-1-yl]ethanone |
|---|---|
| PubChem CID | 20902781 |
| Molecular Formula | C23H23F3N2O3S |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 1-piperidin-1-yl-2-[3-[[4-(trifluoromethyl)phenyl]methylsulfonyl]indol-1-yl]ethanone |
| SMILES | O=C(Cn1cc(S(=O)(=O)Cc2ccc(C(F)(F)F)cc2)c2ccccc21)N1CCCCC1 |
| InChI | InChI=1S/C23H23F3N2O3S/c24-23(25,26)18-10-8-17(9-11-18)16-32(30,31)21-14-28(20-7-3-2-6-19(20)21)15-22(29)27-12-4-1-5-13-27/h2-3,6-11,14H,1,4-5,12-13,15-16H2 |
| InChIKey | WXAXXZBTMNSSQD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |