C24H28N2O3S — CID 43958376
2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]-1-(3-methylpiperidin-1-yl)ethanone (PubChem CID 43958376) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is 2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]-1-(3-methylpiperidin-1-yl)ethanone.
| Compound Name | 2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]-1-(3-methylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 43958376 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]-1-(3-methylpiperidin-1-yl)ethanone |
| SMILES | Cc1ccc(CS(=O)(=O)c2cn(CC(=O)N3CCCC(C)C3)c3ccccc23)cc1 |
| InChI | InChI=1S/C24H28N2O3S/c1-18-9-11-20(12-10-18)17-30(28,29)23-15-26(22-8-4-3-7-21(22)23)16-24(27)25-13-5-6-19(2)14-25/h3-4,7-12,15,19H,5-6,13-14,16-17H2,1-2H3 |
| InChIKey | MKXMXGGIALYLQZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |