C28H29N3O3S — CID 20911132
2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]-1-(4-phenylpiperazin-1-yl)ethanone (PubChem CID 20911132) has the molecular formula C28H29N3O3S and a molecular weight of 487.63 g/mol. Its IUPAC name is 2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]-1-(4-phenylpiperazin-1-yl)ethanone.
| Compound Name | 2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]-1-(4-phenylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 20911132 |
| Molecular Formula | C28H29N3O3S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 2-[3-[(4-methylphenyl)methylsulfonyl]indol-1-yl]-1-(4-phenylpiperazin-1-yl)ethanone |
| SMILES | Cc1ccc(CS(=O)(=O)c2cn(CC(=O)N3CCN(c4ccccc4)CC3)c3ccccc23)cc1 |
| InChI | InChI=1S/C28H29N3O3S/c1-22-11-13-23(14-12-22)21-35(33,34)27-19-31(26-10-6-5-9-25(26)27)20-28(32)30-17-15-29(16-18-30)24-7-3-2-4-8-24/h2-14,19H,15-18,20-21H2,1H3 |
| InChIKey | OISPHGHFTXVPOD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |