C27H27N3O3S — CID 20911073
2-(3-benzylsulfonylindol-1-yl)-1-(4-phenylpiperazin-1-yl)ethanone (PubChem CID 20911073) has the molecular formula C27H27N3O3S and a molecular weight of 473.60 g/mol. Its IUPAC name is 2-(3-benzylsulfonylindol-1-yl)-1-(4-phenylpiperazin-1-yl)ethanone.
| Compound Name | 2-(3-benzylsulfonylindol-1-yl)-1-(4-phenylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 20911073 |
| Molecular Formula | C27H27N3O3S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 2-(3-benzylsulfonylindol-1-yl)-1-(4-phenylpiperazin-1-yl)ethanone |
| SMILES | O=C(Cn1cc(S(=O)(=O)Cc2ccccc2)c2ccccc21)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C27H27N3O3S/c31-27(29-17-15-28(16-18-29)23-11-5-2-6-12-23)20-30-19-26(24-13-7-8-14-25(24)30)34(32,33)21-22-9-3-1-4-10-22/h1-14,19H,15-18,20-21H2 |
| InChIKey | IZEGIMQDXKKRPJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |