C34H38N4O4 — CID 54580817
1-[1-[6-[3-(2-oxo-2-pyrrolidin-1-ylacetyl)indol-1-yl]hexyl]indol-3-yl]-2-pyrrolidin-1-ylethane-1,2-dione (PubChem CID 54580817) has the molecular formula C34H38N4O4 and a molecular weight of 566.70 g/mol. Its IUPAC name is 1-[1-[6-[3-(2-oxo-2-pyrrolidin-1-ylacetyl)indol-1-yl]hexyl]indol-3-yl]-2-pyrrolidin-1-ylethane-1,2-dione.
| Compound Name | 1-[1-[6-[3-(2-oxo-2-pyrrolidin-1-ylacetyl)indol-1-yl]hexyl]indol-3-yl]-2-pyrrolidin-1-ylethane-1,2-dione |
|---|---|
| PubChem CID | 54580817 |
| Molecular Formula | C34H38N4O4 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | 1-[1-[6-[3-(2-oxo-2-pyrrolidin-1-ylacetyl)indol-1-yl]hexyl]indol-3-yl]-2-pyrrolidin-1-ylethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCCC1)c1cn(CCCCCCn2cc(C(=O)C(=O)N3CCCC3)c3ccccc32)c2ccccc12 |
| InChI | InChI=1S/C34H38N4O4/c39-31(33(41)35-17-9-10-18-35)27-23-37(29-15-5-3-13-25(27)29)21-7-1-2-8-22-38-24-28(26-14-4-6-16-30(26)38)32(40)34(42)36-19-11-12-20-36/h3-6,13-16,23-24H,1-2,7-12,17-22H2 |
| InChIKey | XLINOMUQRNXCOK-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 84.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|