C23H30N4O5 — CID 41429456
ethyl 4-[2-[1-[2-(diethylamino)-2-oxoethyl]indol-3-yl]-2-oxoacetyl]piperazine-1-carboxylate (PubChem CID 41429456) has the molecular formula C23H30N4O5 and a molecular weight of 442.52 g/mol. Its IUPAC name is ethyl 4-[2-[1-[2-(diethylamino)-2-oxoethyl]indol-3-yl]-2-oxoacetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[1-[2-(diethylamino)-2-oxoethyl]indol-3-yl]-2-oxoacetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 41429456 |
| Molecular Formula | C23H30N4O5 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | ethyl 4-[2-[1-[2-(diethylamino)-2-oxoethyl]indol-3-yl]-2-oxoacetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C(=O)c2cn(CC(=O)N(CC)CC)c3ccccc23)CC1 |
| InChI | InChI=1S/C23H30N4O5/c1-4-24(5-2)20(28)16-27-15-18(17-9-7-8-10-19(17)27)21(29)22(30)25-11-13-26(14-12-25)23(31)32-6-3/h7-10,15H,4-6,11-14,16H2,1-3H3 |
| InChIKey | JIUWJUGIVPHLJY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 92.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|