C18H33Cl3N4O — CID 119901081
3-amino-2-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]-3-phenylpropanamide;trihydrochloride (PubChem CID 119901081) has the molecular formula C18H33Cl3N4O and a molecular weight of 427.85 g/mol. Its IUPAC name is 3-amino-2-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]-3-phenylpropanamide;trihydrochloride.
| Compound Name | 3-amino-2-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]-3-phenylpropanamide;trihydrochloride |
|---|---|
| PubChem CID | 119901081 |
| Molecular Formula | C18H33Cl3N4O |
| Molecular Weight | 427.85 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 3-amino-2-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]-3-phenylpropanamide;trihydrochloride |
| SMILES | CC(C(=O)NCCCN1CCN(C)CC1)C(N)c1ccccc1.Cl.Cl.Cl |
| InChI | InChI=1S/C18H30N4O.3ClH/c1-15(17(19)16-7-4-3-5-8-16)18(23)20-9-6-10-22-13-11-21(2)12-14-22;;;/h3-5,7-8,15,17H,6,9-14,19H2,1-2H3,(H,20,23);3*1H |
| InChIKey | BATKQUAWACBWML-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.85 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|