C28H40N2O5 — CID 152904226
tert-butyl (2S)-2-[(E,3R)-6-(2,3-dihydroindol-1-yl)-3-(2-methylpropyl)-6-oxohex-4-enoyl]-1,4-oxazepane-4-carboxylate (PubChem CID 152904226) has the molecular formula C28H40N2O5 and a molecular weight of 484.64 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(E,3R)-6-(2,3-dihydroindol-1-yl)-3-(2-methylpropyl)-6-oxohex-4-enoyl]-1,4-oxazepane-4-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(E,3R)-6-(2,3-dihydroindol-1-yl)-3-(2-methylpropyl)-6-oxohex-4-enoyl]-1,4-oxazepane-4-carboxylate |
|---|---|
| PubChem CID | 152904226 |
| Molecular Formula | C28H40N2O5 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | tert-butyl (2S)-2-[(E,3R)-6-(2,3-dihydroindol-1-yl)-3-(2-methylpropyl)-6-oxohex-4-enoyl]-1,4-oxazepane-4-carboxylate |
| SMILES | CC(C)C[C@@H](/C=C/C(=O)N1CCc2ccccc21)CC(=O)[C@@H]1CN(C(=O)OC(C)(C)C)CCCO1 |
| InChI | InChI=1S/C28H40N2O5/c1-20(2)17-21(11-12-26(32)30-15-13-22-9-6-7-10-23(22)30)18-24(31)25-19-29(14-8-16-34-25)27(33)35-28(3,4)5/h6-7,9-12,20-21,25H,8,13-19H2,1-5H3/b12-11+/t21-,25+/m1/s1 |
| InChIKey | UFXLIZXMISJILK-XKAKEGFASA-N |
| XLogP | 4.78 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|