C21H27N3O4 — CID 67772748
(2S)-2-[[(4S)-1-(2,3-dihydroindol-1-yl)-6-methyl-1-oxohept-2-en-4-yl]carbamoyl]azetidine-1-carboxylic acid (PubChem CID 67772748) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is (2S)-2-[[(4S)-1-(2,3-dihydroindol-1-yl)-6-methyl-1-oxohept-2-en-4-yl]carbamoyl]azetidine-1-carboxylic acid.
| Compound Name | (2S)-2-[[(4S)-1-(2,3-dihydroindol-1-yl)-6-methyl-1-oxohept-2-en-4-yl]carbamoyl]azetidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67772748 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | (2S)-2-[[(4S)-1-(2,3-dihydroindol-1-yl)-6-methyl-1-oxohept-2-en-4-yl]carbamoyl]azetidine-1-carboxylic acid |
| SMILES | CC(C)C[C@@H](C=CC(=O)N1CCc2ccccc21)NC(=O)[C@@H]1CCN1C(=O)O |
| InChI | InChI=1S/C21H27N3O4/c1-14(2)13-16(22-20(26)18-10-12-24(18)21(27)28)7-8-19(25)23-11-9-15-5-3-4-6-17(15)23/h3-8,14,16,18H,9-13H2,1-2H3,(H,22,26)(H,27,28)/t16-,18+/m1/s1 |
| InChIKey | YOJWBETYUOHOSW-AEFFLSMTSA-N |
| XLogP | 2.42 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|