C22H28F3N3O4 — CID 67774462
(2S)-N-[(E,3S)-6-(2,3-dihydroindol-1-yl)-6-oxohex-4-en-3-yl]piperidine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 67774462) has the molecular formula C22H28F3N3O4 and a molecular weight of 455.48 g/mol. Its IUPAC name is (2S)-N-[(E,3S)-6-(2,3-dihydroindol-1-yl)-6-oxohex-4-en-3-yl]piperidine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-N-[(E,3S)-6-(2,3-dihydroindol-1-yl)-6-oxohex-4-en-3-yl]piperidine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67774462 |
| Molecular Formula | C22H28F3N3O4 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | (2S)-N-[(E,3S)-6-(2,3-dihydroindol-1-yl)-6-oxohex-4-en-3-yl]piperidine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CC[C@@H](/C=C/C(=O)N1CCc2ccccc21)NC(=O)[C@@H]1CCCCN1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H27N3O2.C2HF3O2/c1-2-16(22-20(25)17-8-5-6-13-21-17)10-11-19(24)23-14-12-15-7-3-4-9-18(15)23;3-2(4,5)1(6)7/h3-4,7,9-11,16-17,21H,2,5-6,8,12-14H2,1H3,(H,22,25);(H,6,7)/b11-10+;/t16-,17-;/m0./s1 |
| InChIKey | GQNPKWMEDANYQJ-BCJCFWTKSA-N |
| XLogP | 2.80 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|