C16H22F3N5O2S — CID 140583697
N-[(E,3S)-6-[methyl-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]-6-oxohex-4-en-3-yl]piperidine-2-carboxamide (PubChem CID 140583697) has the molecular formula C16H22F3N5O2S and a molecular weight of 405.45 g/mol. Its IUPAC name is N-[(E,3S)-6-[methyl-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]-6-oxohex-4-en-3-yl]piperidine-2-carboxamide.
| Compound Name | N-[(E,3S)-6-[methyl-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]-6-oxohex-4-en-3-yl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 140583697 |
| Molecular Formula | C16H22F3N5O2S |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | N-[(E,3S)-6-[methyl-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]-6-oxohex-4-en-3-yl]piperidine-2-carboxamide |
| SMILES | CC[C@@H](/C=C/C(=O)N(C)c1nnc(C(F)(F)F)s1)NC(=O)C1CCCCN1 |
| InChI | InChI=1S/C16H22F3N5O2S/c1-3-10(21-13(26)11-6-4-5-9-20-11)7-8-12(25)24(2)15-23-22-14(27-15)16(17,18)19/h7-8,10-11,20H,3-6,9H2,1-2H3,(H,21,26)/b8-7+/t10-,11?/m0/s1 |
| InChIKey | CIIPWLNNQUBJRY-LHMHPJTCSA-N |
| XLogP | 2.11 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|