C17H24F3N5O2S — CID 140583664
N-[(E,4S)-6-methyl-1-oxo-1-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]hept-2-en-4-yl]piperidine-2-carboxamide (PubChem CID 140583664) has the molecular formula C17H24F3N5O2S and a molecular weight of 419.47 g/mol. Its IUPAC name is N-[(E,4S)-6-methyl-1-oxo-1-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]hept-2-en-4-yl]piperidine-2-carboxamide.
| Compound Name | N-[(E,4S)-6-methyl-1-oxo-1-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]hept-2-en-4-yl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 140583664 |
| Molecular Formula | C17H24F3N5O2S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | N-[(E,4S)-6-methyl-1-oxo-1-[[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]hept-2-en-4-yl]piperidine-2-carboxamide |
| SMILES | CC(C)C[C@@H](/C=C/C(=O)Nc1nnc(C(F)(F)F)s1)NC(=O)C1CCCCN1 |
| InChI | InChI=1S/C17H24F3N5O2S/c1-10(2)9-11(22-14(27)12-5-3-4-8-21-12)6-7-13(26)23-16-25-24-15(28-16)17(18,19)20/h6-7,10-12,21H,3-5,8-9H2,1-2H3,(H,22,27)(H,23,25,26)/b7-6+/t11-,12?/m1/s1 |
| InChIKey | BFZTUKRXXUNRFA-GNHKTISMSA-N |
| XLogP | 2.72 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|